| id | C00004086 |
|---|---|
| Name | 5,7-Dimethoxy-6-C-methylflavone |
| CAS RN | 109251-29-8 |
| Standard InChI | InChI=1S/C18H16O4/c1-11-14(20-2)10-16-17(18(11)21-3)13(19)9-15(22-16)12-7-5-4-6-8-12/h4-10H,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C18H16O4/c1-11-14(20-2)10-16-17(18(11)21-3)13(19)9-15(22-16)12-7-5-4-6-8-12/h4-10H,1-3H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 35 |
| By standard InChI | CHEMBL1685069 |
|---|---|
| By standard InChI Main Layer | CHEMBL1685069 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Leptospermum scoparium | 295139 | Myrtaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P08183 | Multidrug resistance protein 1 | drug | CHEMBL1685069 |
CHEMBL1687396
(1)
|
1 / 0 |
| Q9UNQ0 | ATP-binding cassette sub-family G member 2 | ATP binding cassette | CHEMBL1685069 |
CHEMBL1687393
(1)
CHEMBL1687394
(1)
|
2 / 0 |