| id | C00041295 |
|---|---|
| Name | 8-Hydroxy-1-methoxy-Z-9-heptadecene-4,6-diyn-3-one |
| CAS RN | 65892-85-5 |
| Standard InChI | InChI=1S/C18H26O3/c1-3-4-5-6-7-8-9-12-17(19)13-10-11-14-18(20)15-16-21-2/h9,12,17,19H,3-8,15-16H2,1-2H3/b12-9- |
| Standard InChI (Main Layer) | InChI=1S/C18H26O3/c1-3-4-5-6-7-8-9-12-17(19)13-10-11-14-18(20)15-16-21-2/h9,12,17,19H,3-8,15-16H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 8770 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL479891 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Angelica sinensis | 165353 | Apiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P34969 | 5-hydroxytryptamine receptor 7 | Serotonin receptor | CHEMBL479891 |
CHEMBL977663
(1)
CHEMBL977664
(1)
|
0 / 0 |