| id | C00041348 |
|---|---|
| Name | Ansaspirolide |
| CAS RN | 879496-44-3 |
| Standard InChI | InChI=1S/C24H26O4/c1-3-5-11-20-23-13-12-15(14-19(23)22(26)27-20)17(8-4-2)24(23)18-10-7-6-9-16(18)21(25)28-24/h6-7,9-11,14-15,17H,3-5,8,12-13H2,1-2H3/b20-11-/t15-,17+,23+,24-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C24H26O4/c1-3-5-11-20-23-13-12-15(14-19(23)22(26)27-20)17(8-4-2)24(23)18-10-7-6-9-16(18)21(25)28-24/h6-7,9-11,14-15,17H,3-5,8,12-13H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3928 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL482223 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Angelica sinensis | 165353 | Apiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P34969 | 5-hydroxytryptamine receptor 7 | Serotonin receptor | CHEMBL482223 |
CHEMBL977664
(1)
|
0 / 0 |