| id | C00041466 |
|---|---|
| Name | cyclo(L-Pro-L-Val) |
| CAS RN | 2854-40-2 |
| Standard InChI | InChI=1S/C10H16N2O2/c1-6(2)8-10(14)12-5-3-4-7(12)9(13)11-8/h6-8H,3-5H2,1-2H3,(H,11,13)/t7-,8-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C10H16N2O2/c1-6(2)8-10(14)12-5-3-4-7(12)9(13)11-8/h6-8H,3-5H2,1-2H3,(H,11,13) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 2153 |
| By standard InChI | CHEMBL499570 |
|---|---|
| By standard InChI Main Layer | CHEMBL460243 CHEMBL454463 CHEMBL460676 CHEMBL499570 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Aspergillaceae | 1 |
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Chromocleista sp. | 68830 | Aspergillaceae | Fungi | |
| Streptomyces sp. | 1931 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P25103 | Substance-P receptor | Neurokinin receptor | CHEMBL454463 CHEMBL499570 |
CHEMBL941113
(2)
|
0 / 0 |