| id | C00042157 | 
|---|---|
| Name | 6,7-Dihydroxy-2-methoxy-1,4-phenanthrenedione | 
| CAS RN | 864448-08-8 | 
| Standard InChI | InChI=1S/C15H10O5/c1-20-13-6-12(18)14-8(15(13)19)3-2-7-4-10(16)11(17)5-9(7)14/h2-6,16-17H,1H3 | 
| Standard InChI (Main Layer) | InChI=1S/C15H10O5/c1-20-13-6-12(18)14-8(15(13)19)3-2-7-4-10(16)11(17)5-9(7)14/h2-6,16-17H,1H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1285 | 
| By standard InChI | CHEMBL486392 | 
|---|---|
| By standard InChI Main Layer | CHEMBL486392 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| Liliopsida | 1 | 
| family name | count | 
|---|---|
| Dioscoreaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Dioscorea opposita | 569628 | Dioscoreaceae | Liliopsida | Viridiplantae |