| id | C00042219 |
|---|---|
| Name | alpha-Asarone |
| CAS RN | 2883-98-9 |
| Standard InChI | InChI=1S/C12H16O3/c1-5-6-9-7-11(14-3)12(15-4)8-10(9)13-2/h5-8H,1-4H3/b6-5+ |
| Standard InChI (Main Layer) | InChI=1S/C12H16O3/c1-5-6-9-7-11(14-3)12(15-4)8-10(9)13-2/h5-8H,1-4H3 |
| Phytochemical cluster | No. 6 |
|---|---|
| KCF-S cluster | No. 723 |
| By standard InChI | CHEMBL333306 |
|---|---|
| By standard InChI Main Layer | CHEMBL333306 CHEMBL477752 |
| By LinkDB | C17846 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Piperaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Piper cubeba | 405322 | Piperaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P10635 | Cytochrome P450 2D6 | Cytochrome P450 2D6 | CHEMBL333306 |
CHEMBL970954
(1)
|
1 / 0 |
| P08684 | Cytochrome P450 3A4 | Cytochrome P450 3A4 | CHEMBL333306 |
CHEMBL970953
(1)
|
0 / 1 |