| id | C00042430 |
|---|---|
| Name | cyclo(D-Leu-L-Trp) |
| CAS RN | 56941-94-7 |
| Standard InChI | InChI=1S/C17H21N3O2/c1-10(2)7-14-16(21)20-15(17(22)19-14)8-11-9-18-13-6-4-3-5-12(11)13/h3-6,9-10,14-15,18H,7-8H2,1-2H3,(H,19,22)(H,20,21)/t14-,15+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C17H21N3O2/c1-10(2)7-14-16(21)20-15(17(22)19-14)8-11-9-18-13-6-4-3-5-12(11)13/h3-6,9-10,14-15,18H,7-8H2,1-2H3,(H,19,22)(H,20,21) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1509 |
| By standard InChI | CHEMBL471388 |
|---|---|
| By standard InChI Main Layer | CHEMBL365348 CHEMBL471388 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Aspergillaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Penicillium brevicompactum | 5074 | Aspergillaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P07384 | Calpain-1 catalytic subunit | C2 | CHEMBL365348 |
CHEMBL836260
(1)
|
0 / 0 |