| id | C00042737 |
|---|---|
| Name | Methyl reserpate |
| CAS RN | 2901-66-8 |
| Standard InChI | InChI=1S/C23H30N2O5/c1-28-13-4-5-14-15-6-7-25-11-12-8-19(26)22(29-2)20(23(27)30-3)16(12)10-18(25)21(15)24-17(14)9-13/h4-5,9,12,16,18-20,22,24,26H,6-8,10-11H2,1-3H3/t12-,16+,18-,19-,20+,22+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C23H30N2O5/c1-28-13-4-5-14-15-6-7-25-11-12-8-19(26)22(29-2)20(23(27)30-3)16(12)10-18(25)21(15)24-17(14)9-13/h4-5,9,12,16,18-20,22,24,26H,6-8,10-11H2,1-3H3 |
| Phytochemical cluster | No. 4 |
|---|---|
| KCF-S cluster | No. 229 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1712538 |
| By LinkDB |
|---|
| By CAS RN | C051349 |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Apocynaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Rauwolfia serpentina | 4060 | Apocynaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | Enzyme | CHEMBL1712538 |
CHEMBL1794585
(1)
|
0 / 0 |
| P11473 | Vitamin D3 receptor | NR1I1 | CHEMBL1712538 |
CHEMBL1794311
(1)
|
2 / 3 |
| P17405 | Sphingomyelin phosphodiesterase | Enzyme | CHEMBL1712538 |
CHEMBL1794495
(1)
|
2 / 2 |
| O75496 | Geminin | Unclassified protein | CHEMBL1712538 |
CHEMBL2114843
(1)
|
0 / 0 |
| Q99816 | Tumor susceptibility gene 101 protein | Unclassified protein | CHEMBL1712538 |
CHEMBL1738574
(1)
|
0 / 0 |
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1712538 |
CHEMBL1794483
(1)
|
0 / 0 |
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL1712538 |
CHEMBL1737991
(1)
|
0 / 0 |
| Q8IUX4 | DNA dC->dU-editing enzyme APOBEC-3F | Enzyme | CHEMBL1712538 |
CHEMBL1963966
(1)
|
0 / 0 |
| OMIM | preferred title | UniProt |
|---|---|---|
| #607948 | Mycobacterium tuberculosis, susceptibility to |
P11473
|
| #257200 | Niemann-pick disease, type a |
P17405
|
| #607616 | Niemann-pick disease, type b |
P17405
|
| #277440 | Vitamin d-dependent rickets, type 2a; vddr2a |
P11473
|
| KEGG | disease name | UniProt |
|---|---|---|
| H00342 | Tuberculosis |
P11473
(related)
|
| H00784 | Localized autosomal recessive hypotrichosis |
P11473
(related)
|
| H01143 | Vitamin D-dependent rickets |
P11473
(related)
|
| H00137 | Niemann-Pick disease (NPD) typeA and B |
P17405
(related)
|
| H00424 | Defects in the degradation of sphingomyelin |
P17405
(related)
|