| id | C00042832 |
|---|---|
| Name | Patentiflorin A / (-)-Patentiflorin A |
| CAS RN | 857050-63-6 |
| Standard InChI | InChI=1S/C27H26O11/c1-11-22(28)23(29)24(30)27(37-11)38-25-14-8-18(33-3)17(32-2)7-13(14)20(21-15(25)9-34-26(21)31)12-4-5-16-19(6-12)36-10-35-16/h4-8,11,22-24,27-30H,9-10H2,1-3H3/t11-,22+,23+,24-,27+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C27H26O11/c1-11-22(28)23(29)24(30)27(37-11)38-25-14-8-18(33-3)17(32-2)7-13(14)20(21-15(25)9-34-26(21)31)12-4-5-16-19(6-12)36-10-35-16/h4-8,11,22-24,27-30H,9-10H2,1-3H3 |
| Phytochemical cluster | No. 22 |
|---|---|
| KCF-S cluster | No. 509 |
| By standard InChI | CHEMBL1929103 |
|---|---|
| By standard InChI Main Layer | CHEMBL458904 CHEMBL458905 CHEMBL1929103 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Acanthaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Justicia patentiflora | 4190 | Acanthaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL458904 CHEMBL458905 CHEMBL1929103 |
CHEMBL1930896
(3)
|
0 / 0 |