| id | C00042844 |
|---|---|
| Name | Phaeochromycin A |
| CAS RN | 865795-52-4 |
| Standard InChI | InChI=1S/C18H16O5/c1-2-4-10-7-14(21)18-12(5-3-6-13(18)20)17(10)15-8-11(19)9-16(22)23-15/h3,5-9,19-21H,2,4H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C18H16O5/c1-2-4-10-7-14(21)18-12(5-3-6-13(18)20)17(10)15-8-11(19)9-16(22)23-15/h3,5-9,19-21H,2,4H2,1H3 |
| Phytochemical cluster | No. 17 |
|---|---|
| KCF-S cluster | No. 54 |
| By standard InChI | CHEMBL487190 |
|---|---|
| By standard InChI Main Layer | CHEMBL487190 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces phaeochromogenes LL-PP018 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P49137 | MAP kinase-activated protein kinase 2 | CAMK serine/threonine protein kinase MAPKAPK | CHEMBL487190 |
CHEMBL998215
(1)
|
0 / 0 |