| id | C00043174 |
|---|---|
| Name | 2-Methyl-3H-quinazolin-4-one |
| CAS RN | 1769-24-0 |
| Standard InChI | InChI=1S/C9H8N2O/c1-6-10-8-5-3-2-4-7(8)9(12)11-6/h2-5H,1H3,(H,10,11,12) |
| Standard InChI (Main Layer) | InChI=1S/C9H8N2O/c1-6-10-8-5-3-2-4-7(8)9(12)11-6/h2-5H,1H3,(H,10,11,12) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3292 |
| By standard InChI | CHEMBL395092 |
|---|---|
| By standard InChI Main Layer | CHEMBL395092 |
| By LinkDB |
|---|
| By CAS RN | C067712 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Streptomycetaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Streptomyces sp. GW23/1540 | 1883 | Streptomycetaceae | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P09874 | Poly [ADP-ribose] polymerase 1 | Enzyme | CHEMBL395092 |
CHEMBL763795
(1)
CHEMBL1953234
(2)
|
0 / 0 |
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL395092 |
CHEMBL1794401
(1)
|
0 / 0 |