| id | C00043174 | 
|---|---|
| Name | 2-Methyl-3H-quinazolin-4-one | 
| CAS RN | 1769-24-0 | 
| Standard InChI | InChI=1S/C9H8N2O/c1-6-10-8-5-3-2-4-7(8)9(12)11-6/h2-5H,1H3,(H,10,11,12) | 
| Standard InChI (Main Layer) | InChI=1S/C9H8N2O/c1-6-10-8-5-3-2-4-7(8)9(12)11-6/h2-5H,1H3,(H,10,11,12) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3292 | 
| By standard InChI | CHEMBL395092 | 
|---|---|
| By standard InChI Main Layer | CHEMBL395092 | 
| By LinkDB | 
|---|
| By CAS RN | C067712 | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Streptomycetaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Streptomyces sp. GW23/1540 | 1883 | Streptomycetaceae | Bacteria | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P09874 | Poly [ADP-ribose] polymerase 1 | Enzyme | CHEMBL395092 | CHEMBL763795
                        (1)
                        CHEMBL1953234
                        (2) | 0 / 0 | 
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL395092 | CHEMBL1794401
                        (1) | 0 / 0 |