| id | C00043199 |
|---|---|
| Name | 3''-O-Methylcrenatoside / (-)-3''-O-Methylcrenatoside |
| CAS RN | 719288-66-1 |
| Standard InChI | InChI=1S/C30H36O15/c1-13-23(36)24(37)25(38)29(41-13)45-27-26(44-22(35)8-4-14-3-6-17(33)19(9-14)39-2)20(11-31)43-30-28(27)42-21(12-40-30)15-5-7-16(32)18(34)10-15/h3-10,13,20-21,23-34,36-38H,11-12H2,1-2H3/b8-4+/t13-,20+,21+,23-,24+,25+,26+,27-,28+,29-,30+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C30H36O15/c1-13-23(36)24(37)25(38)29(41-13)45-27-26(44-22(35)8-4-14-3-6-17(33)19(9-14)39-2)20(11-31)43-30-28(27)42-21(12-40-30)15-5-7-16(32)18(34)10-15/h3-10,13,20-21,23-34,36-38H,11-12H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 33 |
| By standard InChI | CHEMBL502701 |
|---|---|
| By standard InChI Main Layer | CHEMBL502701 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Microtoena prainiana | 694372 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P12821 | Angiotensin-converting enzyme | M2 | CHEMBL502701 |
CHEMBL999963
(1)
CHEMBL999964
(1)
CHEMBL999967 (1) |
4 / 2 |