| id | C00043759 |
|---|---|
| Name | Negundoside |
| CAS RN | 82451-20-5 |
| Standard InChI | InChI=1S/C23H28O12/c1-23(31)7-6-12-13(19(28)29)9-32-21(15(12)23)35-22-18(17(27)16(26)14(8-24)33-22)34-20(30)10-2-4-11(25)5-3-10/h2-5,9,12,14-18,21-22,24-27,31H,6-8H2,1H3,(H,28,29)/t12-,14-,15-,16-,17+,18-,21+,22+,23+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C23H28O12/c1-23(31)7-6-12-13(19(28)29)9-32-21(15(12)23)35-22-18(17(27)16(26)14(8-24)33-22)34-20(30)10-2-4-11(25)5-3-10/h2-5,9,12,14-18,21-22,24-27,31H,6-8H2,1H3,(H,28,29) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 213 |
| By standard InChI | CHEMBL519878 |
|---|---|
| By standard InChI Main Layer | CHEMBL239350 CHEMBL519878 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Vitex altissima | 549680 | Lamiaceae | asterids | Viridiplantae |
| Vitex negundo | 361442 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P09917 | Arachidonate 5-lipoxygenase | Oxidoreductase | CHEMBL519878 |
CHEMBL1002859
(1)
|
0 / 0 |