| id | C00044235 | 
|---|---|
| Name | Methyl nicotinate | 
| CAS RN | 93-60-7 | 
| Standard InChI | InChI=1S/C7H7NO2/c1-10-7(9)6-3-2-4-8-5-6/h2-5H,1H3 | 
| Standard InChI (Main Layer) | InChI=1S/C7H7NO2/c1-10-7(9)6-3-2-4-8-5-6/h2-5H,1H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 5102 | 
| By standard InChI | CHEMBL379845 | 
|---|---|
| By standard InChI Main Layer | CHEMBL379845 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| asterids | 1 | 
| Liliopsida | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Areca catechu | 184783 | Arecaceae | Liliopsida | Viridiplantae | 
| Osmanthus austrocaledonica | 93976 | Oleaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P11473 | Vitamin D3 receptor | NR1I1 | CHEMBL379845 | CHEMBL1794311
                        (1) | 2 / 3 | 
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL379845 | CHEMBL1614458
                        (1) | 0 / 0 | 
| Q92830 | Histone acetyltransferase KAT2A | Enzyme | CHEMBL379845 | CHEMBL1738606
                        (1) | 0 / 0 | 
| Q96KQ7 | Histone-lysine N-methyltransferase EHMT2 | Enzyme | CHEMBL379845 | CHEMBL1738442
                        (1) | 0 / 0 | 
| Q13951 | Core-binding factor subunit beta | Unclassified protein | CHEMBL379845 | CHEMBL1613933
                        (1) | 0 / 1 | 
| Q01196 | Runt-related transcription factor 1 | Unclassified protein | CHEMBL379845 | CHEMBL1613933
                        (1) | 1 / 6 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #607948 | Mycobacterium tuberculosis, susceptibility to | P11473 | 
| #601399 | Platelet disorder, familial, with associated myeloid malignancy | Q01196 | 
| #277440 | Vitamin d-dependent rickets, type 2a; vddr2a | P11473 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00342 | Tuberculosis | P11473
                            (related) | 
| H00784 | Localized autosomal recessive hypotrichosis | P11473
                            (related) | 
| H01143 | Vitamin D-dependent rickets | P11473
                            (related) | 
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) | Q01196
                            (related) Q01196 (marker) | 
| H00003 | Acute myeloid leukemia (AML) | Q01196
                            (related) Q01196 (marker) Q13951 (marker) | 
| H00004 | Chronic myeloid leukemia (CML) | Q01196
                            (related) | 
| H00978 | Thrombocytopenia (THC) | Q01196
                            (related) |