| id | C00044287 | 
|---|---|
| Name | Propionic acid | 
| CAS RN | 79-09-4 | 
| Standard InChI | InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5) | 
| Standard InChI (Main Layer) | InChI=1S/C3H6O2/c1-2-3(4)5/h2H2,1H3,(H,4,5) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 6558 | 
| By standard InChI | CHEMBL14021 | 
|---|---|
| By standard InChI Main Layer | CHEMBL14021 | 
| By LinkDB | C00163 | 
|---|
| By CAS RN | C029658 | 
|---|
| class name | count | 
|---|---|
| asterids | 1 | 
| family name | count | 
|---|---|
| Convolvulaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Cuscuta chinensis | 267557 | Convolvulaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q9UGP5 | DNA polymerase lambda | Enzyme | CHEMBL14021 | CHEMBL1921596
                        (1)
                        CHEMBL1920071
                        (1) | 0 / 0 | 
| O15552 | Free fatty acid receptor 2 | Free fatty acid receptor | CHEMBL14021 | CHEMBL1069216
                        (1)
                        CHEMBL1069226
                        (1) | 0 / 0 | 
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL14021 | CHEMBL1921592
                        (1)
                        CHEMBL1921595
                        (1) | 0 / 0 |