| id | C00045021 |
|---|---|
| Name | Pochonin E / (-)-Pochonin E |
| CAS RN | 544712-83-6 |
| Standard InChI | InChI=1S/C18H19ClO6/c1-10-4-2-5-11(20)6-3-7-12(21)8-13-16(18(24)25-10)14(22)9-15(23)17(13)19/h2-3,5,7,9-11,20,22-23H,4,6,8H2,1H3/b5-2+,7-3+/t10-,11-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C18H19ClO6/c1-10-4-2-5-11(20)6-3-7-12(21)8-13-16(18(24)25-10)14(22)9-15(23)17(13)19/h2-3,5,7,9-11,20,22-23H,4,6,8H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 871 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL449441 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Clavicipitaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Pochonia chlamydosporia var.catenulata strain P0297 | 243023 | Clavicipitaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q92731 | Estrogen receptor beta | NR3A2 | CHEMBL449441 |
CHEMBL992089
(1)
|
0 / 1 |