| id | C00045022 |
|---|---|
| Name | Pochonin F |
| CAS RN | 544712-84-7 |
| Standard InChI | InChI=1S/C18H20O5/c1-12-5-2-7-14(19)8-4-9-15(20)11-13-6-3-10-16(21)17(13)18(22)23-12/h2-4,6-7,9-10,12,14,19,21H,5,8,11H2,1H3/b7-2+,9-4+/t12-,14?/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C18H20O5/c1-12-5-2-7-14(19)8-4-9-15(20)11-13-6-3-10-16(21)17(13)18(22)23-12/h2-4,6-7,9-10,12,14,19,21H,5,8,11H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 871 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL461398 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Clavicipitaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Pochonia chlamydosporia var.catenulata strain P0297 | 243023 | Clavicipitaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q92731 | Estrogen receptor beta | NR3A2 | CHEMBL461398 |
CHEMBL992089
(1)
|
0 / 1 |