| id | C00004534 |
|---|---|
| Name | 3-Methylgalangin / Galangin 3-methyl ether / 5,7-Dihydroxy-3-methoxyflavone / 5,7-Dihydroxy-3-methoxy-2-phenyl-4H-1-benzopyran-4-one |
| CAS RN | 6665-74-3 |
| Standard InChI | InChI=1S/C16H12O5/c1-20-16-14(19)13-11(18)7-10(17)8-12(13)21-15(16)9-5-3-2-4-6-9/h2-8,17-18H,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C16H12O5/c1-20-16-14(19)13-11(18)7-10(17)8-12(13)21-15(16)9-5-3-2-4-6-9/h2-8,17-18H,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | CHEMBL1822221 |
|---|---|
| By standard InChI Main Layer | CHEMBL1822221 |
| By LinkDB | C11577 |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 17 |
| Euphyllophyta | 3 |
| rosids | 2 |
| family name | count |
|---|---|
| Boraginaceae | 7 |
| Asteraceae | 7 |
| Pteridaceae | 2 |
| Scrophulariaceae | 2 |
| Ericaceae | 1 |
| Woodsiaceae | 1 |
| Nothofagaceae | 1 |
| Salicaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P08183 | Multidrug resistance protein 1 | drug | CHEMBL1822221 |
CHEMBL1827948
(1)
|
1 / 0 |