| id | C00045536 |
|---|---|
| Name | 2,5-Dideoxy-2,5-imino-glycero-D-manno-heptitol |
| CAS RN | 197390-30-0 |
| Standard InChI | InChI=1S/C7H15NO5/c9-1-3-6(12)7(13)5(8-3)4(11)2-10/h3-13H,1-2H2/t3-,4?,5-,6-,7-/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C7H15NO5/c9-1-3-6(12)7(13)5(8-3)4(11)2-10/h3-13H,1-2H2 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 667 |
| By standard InChI | CHEMBL456077 |
|---|---|
| By standard InChI Main Layer | CHEMBL406972 CHEMBL456077 CHEMBL488156 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Liliopsida | 1 |
| family name | count |
|---|---|
| Hyacinthaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Scilla sibirica | 4701 | Hyacinthaceae | Liliopsida | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P35573 | Glycogen debranching enzyme | Enzyme | CHEMBL406972 |
CHEMBL923883
(1)
|
1 / 1 |