| id | C00045573 |
|---|---|
| Name | 5,7,2',4-Tetrahydroxy-3-geranylflavone |
| CAS RN | 376361-87-4 |
| Standard InChI | InChI=1S/C25H26O6/c1-14(2)5-4-6-15(3)7-9-19-24(30)23-21(29)12-17(27)13-22(23)31-25(19)18-10-8-16(26)11-20(18)28/h5,7-8,10-13,26-29H,4,6,9H2,1-3H3/b15-7+ |
| Standard InChI (Main Layer) | InChI=1S/C25H26O6/c1-14(2)5-4-6-15(3)7-9-19-24(30)23-21(29)12-17(27)13-22(23)31-25(19)18-10-8-16(26)11-20(18)28/h5,7-8,10-13,26-29H,4,6,9H2,1-3H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 14 |
| By standard InChI | CHEMBL458187 |
|---|---|
| By standard InChI Main Layer | CHEMBL458187 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Broussonetia papyrifera | 172644 | Moraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL458187 |
CHEMBL949646
(1)
|
2 / 2 |