| id | C00045574 |
|---|---|
| Name | 5,7,3',4'-Tetrahydroxy-3-methoxy-6-geranylflavone |
| CAS RN | 376361-93-2 |
| Standard InChI | InChI=1S/C26H28O7/c1-14(2)6-5-7-15(3)8-10-17-19(28)13-21-22(23(17)30)24(31)26(32-4)25(33-21)16-9-11-18(27)20(29)12-16/h6,8-9,11-13,27-30H,5,7,10H2,1-4H3/b15-8+ |
| Standard InChI (Main Layer) | InChI=1S/C26H28O7/c1-14(2)6-5-7-15(3)8-10-17-19(28)13-21-22(23(17)30)24(31)26(32-4)25(33-21)16-9-11-18(27)20(29)12-16/h6,8-9,11-13,27-30H,5,7,10H2,1-4H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 14 |
| By standard InChI | CHEMBL457262 |
|---|---|
| By standard InChI Main Layer | CHEMBL457262 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Broussonetia papyrifera | 172644 | Moraceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11511 | Cytochrome P450 19A1 | Cytochrome P450 19A1 | CHEMBL457262 |
CHEMBL949646
(1)
|
2 / 2 |