| id | C00046345 |
|---|---|
| Name | Radiosumin B / (+)-Radiosumin B |
| CAS RN | 349123-58-6 |
| Standard InChI | InChI=1S/C23H32N4O5/c1-14(28)25-19-10-6-17(7-11-19)13-21(23(31)32)27-22(30)20(26-15(2)29)12-16-4-8-18(24-3)9-5-16/h4,6,8,10,12-13,18-21,24H,5,7,9,11H2,1-3H3,(H,25,28)(H,26,29)(H,27,30)(H,31,32)/b16-12-,17-13-/t18-,19-,20-,21-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C23H32N4O5/c1-14(28)25-19-10-6-17(7-11-19)13-21(23(31)32)27-22(30)20(26-15(2)29)12-16-4-8-18(24-3)9-5-16/h4,6,8,10,12-13,18-21,24H,5,7,9,11H2,1-3H3,(H,25,28)(H,26,29)(H,27,30)(H,31,32) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3758 |
| By standard InChI | CHEMBL478092 |
|---|---|
| By standard InChI Main Layer | CHEMBL478092 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Microcystis aeruginosa | 1126 | Bacteria |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00747 | Plasminogen | S1A | CHEMBL478092 |
CHEMBL996200
(1)
|
1 / 2 |