| id | C00046415 | 
|---|---|
| Name | Squamolone | 
| CAS RN | 40451-67-0 | 
| Standard InChI | InChI=1S/C5H8N2O2/c6-5(9)7-3-1-2-4(7)8/h1-3H2,(H2,6,9) | 
| Standard InChI (Main Layer) | InChI=1S/C5H8N2O2/c6-5(9)7-3-1-2-4(7)8/h1-3H2,(H2,6,9) | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4369 | 
| By standard InChI | CHEMBL506960 | 
|---|---|
| By standard InChI Main Layer | CHEMBL506960 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| Magnoliophyta | 1 | 
| family name | count | 
|---|---|
| Annonaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Artabotrys uncinatus | 225832 | Annonaceae | Magnoliophyta | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | 
                        # of diseases
                         (OMIM / KEGG)  | 
                    
|---|---|---|---|---|---|
| P00734 | Prothrombin | S1A | CHEMBL506960 | 
                        CHEMBL944432
                        (1)
                         | 
                      4 / 2 |