| id | C00046415 |
|---|---|
| Name | Squamolone |
| CAS RN | 40451-67-0 |
| Standard InChI | InChI=1S/C5H8N2O2/c6-5(9)7-3-1-2-4(7)8/h1-3H2,(H2,6,9) |
| Standard InChI (Main Layer) | InChI=1S/C5H8N2O2/c6-5(9)7-3-1-2-4(7)8/h1-3H2,(H2,6,9) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4369 |
| By standard InChI | CHEMBL506960 |
|---|---|
| By standard InChI Main Layer | CHEMBL506960 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| Magnoliophyta | 1 |
| family name | count |
|---|---|
| Annonaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Artabotrys uncinatus | 225832 | Annonaceae | Magnoliophyta | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00734 | Prothrombin | S1A | CHEMBL506960 |
CHEMBL944432
(1)
|
4 / 2 |