| id | C00046781 | 
|---|---|
| Name | Isomalyngamide A / (-)-Isomalyngamide A | 
| CAS RN | 312612-82-1 | 
| Standard InChI | InChI=1S/C29H45ClN2O6/c1-6-7-8-9-11-14-24(36-3)15-12-10-13-16-27(33)31(2)21-23(20-30)17-25(37-4)18-28(34)32-22-26(38-5)19-29(32)35/h10,12,18-20,24H,6-9,11,13-17,21-22H2,1-5H3/b12-10+,23-20-,25-18+/t24-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C29H45ClN2O6/c1-6-7-8-9-11-14-24(36-3)15-12-10-13-16-27(33)31(2)21-23(20-30)17-25(37-4)18-28(34)32-22-26(38-5)19-29(32)35/h10,12,18-20,24H,6-9,11,13-17,21-22H2,1-5H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3031 | 
| By standard InChI | CHEMBL2147270 | 
|---|---|
| By standard InChI Main Layer | CHEMBL1357867 CHEMBL2147270 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Lyngbya majuscula | 158786 | Bacteria | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P04637 | Cellular tumor antigen p53 | Transcription Factor | CHEMBL1357867 | CHEMBL1738132
                        (1)
                        CHEMBL2114753
                        (1) | 7 / 44 | 
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL1357867 | CHEMBL2114784
                        (1) | 1 / 1 | 
| Q13315 | Serine-protein kinase ATM | Atypical serine/threonine protein kinase PIKK subfamily | CHEMBL1357867 | CHEMBL1614153
                        (1) | 1 / 4 | 
| P07550 | Beta-2 adrenergic receptor | Adrenergic receptor | CHEMBL1357867 | CHEMBL1738166
                        (1) | 0 / 1 | 
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL1357867 | CHEMBL1794584
                        (1) | 2 / 0 | 
| O75496 | Geminin | Unclassified protein | CHEMBL1357867 | CHEMBL2114843
                        (1)
                        CHEMBL2114780
                        (1) | 0 / 0 | 
| Q9Y253 | DNA polymerase eta | Enzyme | CHEMBL1357867 | CHEMBL1794569
                        (1) | 1 / 1 | 
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL1357867 | CHEMBL1794401
                        (1) | 0 / 0 | 
| P51843 | Nuclear receptor subfamily 0 group B member 1 | Nuclear hormone receptor subfamily 0 group B member 1 | CHEMBL1357867 | CHEMBL2354292
                        (1) | 2 / 2 | 
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1357867 | CHEMBL1738588
                        (1)
                        CHEMBL1738317
                        (1) CHEMBL2114929 (1) | 0 / 0 | 
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL1357867 | CHEMBL1794483
                        (1) | 0 / 0 | 
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL1357867 | CHEMBL1738184
                        (1) | 0 / 0 | 
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL1357867 | CHEMBL2354311
                        (1) | 1 / 0 | 
| Q8IUX4 | DNA dC->dU-editing enzyme APOBEC-3F | Enzyme | CHEMBL1357867 | CHEMBL1963966
                        (1) | 0 / 0 | 
| P01215 | Glycoprotein hormones alpha chain | Unclassified protein | CHEMBL1357867 | CHEMBL2114913
                        (1) | 0 / 3 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #300018 | 46,xy sex reversal 2; srxy2 | P51843 | 
| #300200 | Adrenal hypoplasia, congenital; ahc | P51843 | 
| #202300 | Adrenocortical carcinoma, hereditary; adcc | P04637 | 
| #208900 | Ataxia-telangiectasia; at | Q13315 | 
| #614740 | Basal cell carcinoma, susceptibility to, 7; bcc7 | P04637 | 
| #114500 | Colorectal cancer; crc | P84022 | 
| #133239 | Esophageal cancer | P04637 | 
| #137800 | Glioma susceptibility 1; glm1 | O75874 | 
| #151623 | Li-fraumeni syndrome 1; lfs1 | P04637 | 
| #613795 | Loeys-dietz syndrome, type 3; lds3 | P84022 | 
| #211980 | Lung cancer | P04637 | 
| #260500 | Papilloma of choroid plexus; cpp | P04637 | 
| #183090 | Spinocerebellar ataxia 2; sca2 | Q99700 | 
| #275355 | Squamous cell carcinoma, head and neck; hnscc | P04637 | 
| #278750 | Xeroderma pigmentosum, variant type; xpv | Q9Y253 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00081 | Hashimoto's thyroiditis | P01215
                            (marker) | 
| H00082 | Graves' disease | P01215
                            (marker) | 
| H00250 | Congenital nongoitrous hypothyroidism (CHNG) | P01215
                            (marker) | 
| H00004 | Chronic myeloid leukemia (CML) | P04637
                            (related) | 
| H00005 | Chronic lymphocytic leukemia (CLL) | P04637
                            (related) Q13315 (related) | 
| H00006 | Hairy-cell leukemia | P04637
                            (related) | 
| H00008 | Burkitt lymphoma | P04637
                            (related) | 
| H00009 | Adult T-cell leukemia | P04637
                            (related) | 
| H00010 | Multiple myeloma | P04637
                            (related) | 
| H00013 | Small cell lung cancer | P04637
                            (related) | 
| H00014 | Non-small cell lung cancer | P04637
                            (related) | 
| H00015 | Malignant pleural mesothelioma | P04637
                            (related) | 
| H00016 | Oral cancer | P04637
                            (related) P04637 (marker) | 
| H00017 | Esophageal cancer | P04637
                            (related) P04637 (marker) | 
| H00018 | Gastric cancer | P04637
                            (related) | 
| H00019 | Pancreatic cancer | P04637
                            (related) P04637 (marker) | 
| H00020 | Colorectal cancer | P04637
                            (related) P04637 (marker) | 
| H00022 | Bladder cancer | P04637
                            (related) | 
| H00025 | Penile cancer | P04637
                            (related) P04637 (marker) | 
| H00026 | Endometrial Cancer | P04637
                            (related) | 
| H00027 | Ovarian cancer | P04637
                            (related) | 
| H00028 | Choriocarcinoma | P04637
                            (related) | 
| H00029 | Vulvar cancer | P04637
                            (related) | 
| H00031 | Breast cancer | P04637
                            (related) | 
| H00032 | Thyroid cancer | P04637
                            (related) | 
| H00033 | Adrenal carcinoma | P04637
                            (related) | 
| H00036 | Osteosarcoma | P04637
                            (related) | 
| H00038 | Malignant melanoma | P04637
                            (related) | 
| H00039 | Basal cell carcinoma | P04637
                            (related) | 
| H00040 | Squamous cell carcinoma | P04637
                            (related) | 
| H00041 | Kaposi's sarcoma | P04637
                            (related) | 
| H00042 | Glioma | P04637
                            (related) P04637 (marker) | 
| H00044 | Cancer of the anal canal | P04637
                            (related) | 
| H00046 | Cholangiocarcinoma | P04637
                            (related) | 
| H00047 | Gallbladder cancer | P04637
                            (related) | 
| H00048 | Hepatocellular carcinoma | P04637
                            (related) | 
| H00055 | Laryngeal cancer | P04637
                            (related) P04637 (marker) | 
| H00881 | Li-Fraumeni syndrome | P04637
                            (related) | 
| H01007 | Choroid plexus papilloma | P04637
                            (related) | 
| H00021 | Renal cell carcinoma | P04637
                            (marker) | 
| H00079 | Asthma | P07550
                            (related) | 
| H00552 | Glycerol kinase deficiency (GKD) | P51843
                            (related) | 
| H00607 | 46,XY disorders of sex development (Disorders of gonadal development) | P51843
                            (related) | 
| H00064 | Ataxia telangiectasia (AT) | Q13315
                            (related) | 
| H00094 | DNA repair defects | Q13315
                            (related) | 
| H00848 | Ataxia with ocular apraxia (AOA) | Q13315
                            (related) | 
| H00063 | Spinocerebellar ataxia (SCA) | Q99700
                            (related) | 
| H00403 | Disorders of nucleotide excision repair | Q9Y253
                            (related) |