| id | C00046782 | 
|---|---|
| Name | Isomalyngamide B / (+)-Isomalyngamide B | 
| CAS RN | 312613-11-9 | 
| Standard InChI | InChI=1S/C28H45ClN2O6/c1-5-6-7-8-10-13-24(36-3)14-11-9-12-15-26(33)30(2)20-22(19-29)16-25(37-4)18-28(35)31-21-23(32)17-27(31)34/h9,11,18-19,23-24,32H,5-8,10,12-17,20-21H2,1-4H3/b11-9+,22-19-,25-18+/t23-,24+/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C28H45ClN2O6/c1-5-6-7-8-10-13-24(36-3)14-11-9-12-15-26(33)30(2)20-22(19-29)16-25(37-4)18-28(35)31-21-23(32)17-27(31)34/h9,11,18-19,23-24,32H,5-8,10,12-17,20-21H2,1-4H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 3031 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1702391 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Lyngbya majuscula | 158786 | Bacteria | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| Q99700 | Ataxin-2 | Unclassified protein | CHEMBL1702391 | CHEMBL2114784
                        (1) | 1 / 1 | 
| Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | Enzyme | CHEMBL1702391 | CHEMBL1794585
                        (1) | 0 / 0 | 
| P37840 | Alpha-synuclein | Unclassified protein | CHEMBL1702391 | CHEMBL2354282
                        (1) | 4 / 2 | 
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL1702391 | CHEMBL1794584
                        (1) | 2 / 0 | 
| O75496 | Geminin | Unclassified protein | CHEMBL1702391 | CHEMBL2114843
                        (1)
                        CHEMBL2114780
                        (1) | 0 / 0 | 
| P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1702391 | CHEMBL2114788
                        (1) | 0 / 0 | 
| P63092 | Guanine nucleotide-binding protein G(s) subunit alpha isoforms short | Other membrane protein | CHEMBL1702391 | CHEMBL2114817
                        (1) | 7 / 3 | 
| P83916 | Chromobox protein homolog 1 | Unclassified protein | CHEMBL1702391 | CHEMBL1794401
                        (1) | 0 / 0 | 
| Q96QE3 | ATPase family AAA domain-containing protein 5 | Unclassified protein | CHEMBL1702391 | CHEMBL1738588
                        (1) | 0 / 0 | 
| Q16236 | Nuclear factor erythroid 2-related factor 2 | Unclassified protein | CHEMBL1702391 | CHEMBL1738184
                        (1) | 0 / 0 | 
| O75874 | Isocitrate dehydrogenase [NADP] cytoplasmic | Enzyme | CHEMBL1702391 | CHEMBL2354311
                        (1) | 1 / 0 | 
| Q13148 | TAR DNA-binding protein 43 | Unclassified protein | CHEMBL1702391 | CHEMBL2354287
                        (1) | 1 / 1 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #219080 | Acth-independent macronodular adrenal hyperplasia; aimah | P63092 | 
| #612069 | Amyotrophic lateral sclerosis 10, with or without frontotemporal dementia; als10 | Q13148 | 
| #114500 | Colorectal cancer; crc | P84022 | 
| #127750 | Dementia, lewy body; dlb | P37840 | 
| #137800 | Glioma susceptibility 1; glm1 | O75874 | 
| #613795 | Loeys-dietz syndrome, type 3; lds3 | P84022 | 
| #174800 | Mccune-albright syndrome; mas | P63092 | 
| #166350 | Osseous heteroplasia, progressive; poh | P63092 | 
| #168601 | Parkinson disease 1, autosomal dominant; park1 | P37840 | 
| #605543 | Parkinson disease 4, autosomal dominant; park4 | P37840 | 
| #168600 | Parkinson disease, late-onset; pd | P37840 | 
| #102200 | Pituitary adenoma, growth hormone-secreting | P63092 | 
| #103580 | Pseudohypoparathyroidism, type ia; php1a | P63092 | 
| #603233 | Pseudohypoparathyroidism, type ib; php1b | P63092 | 
| #612462 | Pseudohypoparathyroidism, type ic; php1c | P63092 | 
| #183090 | Spinocerebellar ataxia 2; sca2 | Q99700 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00057 | Parkinson's disease (PD) | P37840
                            (related) | 
| H00066 | Lewy body dementia (LBD) | P37840
                            (related) | 
| H00244 | Pseudohypoparathyroidism | P63092
                            (related) | 
| H00441 | Progressive osseous heteroplasia (POH) | P63092
                            (related) | 
| H00501 | Fibrous dysplasia, polyostotic | P63092
                            (related) | 
| H00058 | Amyotrophic lateral sclerosis (ALS) | Q13148
                            (related) | 
| H00063 | Spinocerebellar ataxia (SCA) | Q99700
                            (related) |