| id | C00047368 |
|---|---|
| Name | 8-Epirhynchosperin A / (-)-8-Epirhynchosperin A |
| CAS RN | 1158090-87-9 |
| Standard InChI | InChI=1S/C20H20O6/c1-19-8-15(11-5-7-24-9-11)26-18(23)12(19)4-6-20-10-25-17(22)13(20)2-3-14(21)16(19)20/h2-3,5,7,9,12-13,15-16H,4,6,8,10H2,1H3/t12-,13-,15-,16+,19-,20+/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C20H20O6/c1-19-8-15(11-5-7-24-9-11)26-18(23)12(19)4-6-20-10-25-17(22)13(20)2-3-14(21)16(19)20/h2-3,5,7,9,12-13,15-16H,4,6,8,10H2,1H3 |
| Phytochemical cluster | No. 43 |
|---|---|
| KCF-S cluster | No. 2453 |
| By standard InChI | CHEMBL1086147 |
|---|---|
| By standard InChI Main Layer | CHEMBL1086147 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Heteroplexis microcephala | 4210 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P18031 | Tyrosine-protein phosphatase non-receptor type 1 | Tyr | CHEMBL1086147 |
CHEMBL1110488
(1)
|
0 / 0 |