| id | C00047406 |
|---|---|
| Name | Brevipolide D / (+)-Brevipolide D |
| CAS RN | 1149341-16-1 |
| Standard InChI | InChI=1S/C21H22O8/c1-11(28-19(25)8-6-12-5-7-15(22)16(23)9-12)20(26)13-10-14(13)21(27)17-3-2-4-18(24)29-17/h2,4-9,11,13-14,17,21-23,27H,3,10H2,1H3/b8-6-/t11?,13-,14-,17+,21-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H22O8/c1-11(28-19(25)8-6-12-5-7-15(22)16(23)9-12)20(26)13-10-14(13)21(27)17-3-2-4-18(24)29-17/h2,4-9,11,13-14,17,21-23,27H,3,10H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1573 |
| By standard InChI | CHEMBL1086651 |
|---|---|
| By standard InChI Main Layer | CHEMBL1086650 CHEMBL1086651 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Hyptis brevipes | 204123 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P19838 | Nuclear factor NF-kappa-B p105 subunit | Transcription Factor | CHEMBL1086650 CHEMBL1086651 |
CHEMBL1108521
(2)
|
0 / 0 |