| id | C00047407 |
|---|---|
| Name | Brevipolide E / (+)-Brevipolide E |
| CAS RN | 1149341-18-3 |
| Standard InChI | InChI=1S/C23H24O9/c1-12(30-21(28)9-7-14-6-8-17(25)18(26)10-14)22(29)15-11-16(15)23(31-13(2)24)19-4-3-5-20(27)32-19/h3,5-10,12,15-16,19,23,25-26H,4,11H2,1-2H3/b9-7+/t12?,15-,16-,19+,23-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C23H24O9/c1-12(30-21(28)9-7-14-6-8-17(25)18(26)10-14)22(29)15-11-16(15)23(31-13(2)24)19-4-3-5-20(27)32-19/h3,5-10,12,15-16,19,23,25-26H,4,11H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1573 |
| By standard InChI | CHEMBL1088210 |
|---|---|
| By standard InChI Main Layer | CHEMBL1088210 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Hyptis brevipes | 204123 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P19838 | Nuclear factor NF-kappa-B p105 subunit | Transcription Factor | CHEMBL1088210 |
CHEMBL1108521
(1)
|
0 / 0 |