| id | C00047408 |
|---|---|
| Name | Brevipolide F / (+)-Brevipolide F |
| CAS RN | 1149341-19-4 |
| Standard InChI | InChI=1S/C21H22O7/c1-12(27-19(24)10-7-13-5-8-14(22)9-6-13)20(25)15-11-16(15)21(26)17-3-2-4-18(23)28-17/h2,4-10,12,15-17,21-22,26H,3,11H2,1H3/b10-7-/t12?,15-,16-,17+,21-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C21H22O7/c1-12(27-19(24)10-7-13-5-8-14(22)9-6-13)20(25)15-11-16(15)21(26)17-3-2-4-18(23)28-17/h2,4-10,12,15-17,21-22,26H,3,11H2,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1573 |
| By standard InChI | CHEMBL1085427 |
|---|---|
| By standard InChI Main Layer | CHEMBL363999 CHEMBL1085427 CHEMBL2337108 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Hyptis brevipes | 204123 | Lamiaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P51681 | C-C chemokine receptor type 5 | CC chemokine receptor | CHEMBL363999 |
CHEMBL824893
(1)
CHEMBL837923
(1)
CHEMBL874928 (1) |
3 / 0 |
| P19838 | Nuclear factor NF-kappa-B p105 subunit | Transcription Factor | CHEMBL363999 CHEMBL1085427 |
CHEMBL1108521
(2)
|
0 / 0 |