id | C00004764 |
---|---|
Name | Myricetin 3,4'-dimethyl ether |
CAS RN | 71325-90-1 |
Standard InChI | InChI=1S/C17H14O8/c1-23-16-10(20)3-7(4-11(16)21)15-17(24-2)14(22)13-9(19)5-8(18)6-12(13)25-15/h3-6,18-21H,1-2H3 |
Standard InChI (Main Layer) | InChI=1S/C17H14O8/c1-23-16-10(20)3-7(4-11(16)21)15-17(24-2)14(22)13-9(19)5-8(18)6-12(13)25-15/h3-6,18-21H,1-2H3 |
Phytochemical cluster | No. 15 |
---|---|
KCF-S cluster | No. 3 |
By standard InChI | CHEMBL1689268 |
---|---|
By standard InChI Main Layer | CHEMBL1689268 |
By LinkDB |
---|
By CAS RN |
---|
class name | count |
---|---|
eudicotyledons | 2 |
asterids | 2 |
family name | count |
---|---|
Didiereaceae | 2 |
Asteraceae | 2 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Alluaudia ascendens | 86287 | Didiereaceae | eudicotyledons | Viridiplantae |
Decaryia madagascariensis | 3584 | Didiereaceae | eudicotyledons | Viridiplantae |
Gutierrezia grandis | 71047 | Asteraceae | asterids | Viridiplantae |
Gutierrezia texana | 71048 | Asteraceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
O14763 | Tumor necrosis factor receptor superfamily member 10B | Unclassified protein | CHEMBL1689268 |
CHEMBL1693927
(1)
|
1 / 0 |