| id | C00004764 |
|---|---|
| Name | Myricetin 3,4'-dimethyl ether |
| CAS RN | 71325-90-1 |
| Standard InChI | InChI=1S/C17H14O8/c1-23-16-10(20)3-7(4-11(16)21)15-17(24-2)14(22)13-9(19)5-8(18)6-12(13)25-15/h3-6,18-21H,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C17H14O8/c1-23-16-10(20)3-7(4-11(16)21)15-17(24-2)14(22)13-9(19)5-8(18)6-12(13)25-15/h3-6,18-21H,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 3 |
| By standard InChI | CHEMBL1689268 |
|---|---|
| By standard InChI Main Layer | CHEMBL1689268 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| eudicotyledons | 2 |
| asterids | 2 |
| family name | count |
|---|---|
| Didiereaceae | 2 |
| Asteraceae | 2 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Alluaudia ascendens | 86287 | Didiereaceae | eudicotyledons | Viridiplantae |
| Decaryia madagascariensis | 3584 | Didiereaceae | eudicotyledons | Viridiplantae |
| Gutierrezia grandis | 71047 | Asteraceae | asterids | Viridiplantae |
| Gutierrezia texana | 71048 | Asteraceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O14763 | Tumor necrosis factor receptor superfamily member 10B | Unclassified protein | CHEMBL1689268 |
CHEMBL1693927
(1)
|
1 / 0 |