| id | C00047668 | 
|---|---|
| Name | 4-Allylcatechol | 
| CAS RN | 1126-61-0 | 
| Standard InChI | InChI=1S/C9H10O2/c1-2-3-7-4-5-8(10)9(11)6-7/h2,4-6,10-11H,1,3H2 | 
| Standard InChI (Main Layer) | InChI=1S/C9H10O2/c1-2-3-7-4-5-8(10)9(11)6-7/h2,4-6,10-11H,1,3H2 | 
| Phytochemical cluster | No. 6 | 
|---|---|
| KCF-S cluster | No. 1114 | 
| By standard InChI | CHEMBL111134 | 
|---|---|
| By standard InChI Main Layer | CHEMBL111134 | 
| By LinkDB | 
|---|
| By CAS RN | C051268 | 
|---|
| class name | count | 
|---|---|
| Magnoliophyta | 1 | 
| family name | count | 
|---|---|
| Lauraceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Cinnamomum tenuifolium | 13428 | Lauraceae | Magnoliophyta | Viridiplantae | 
| compound | gene | gene name | gene description | interaction | interaction type | form | reference pmid | 
|---|---|---|---|---|---|---|---|
| C051268 | 23563 | CHST5 I-GlcNAc-6-ST I-GlcNAc6ST glcNAc6ST-3 gn6st-3 hIGn6ST | carbohydrate (N-acetylglucosamine 6-O) sulfotransferase 5 | 2-hydroxychavicol results in increased expression of CHST5 mRNA | increases expression | mRNA | 15331132 | 
| C051268 | 4166 | CHST6 MCDC1 | carbohydrate (N-acetylglucosamine 6-O) sulfotransferase 6 | 2-hydroxychavicol results in increased expression of CHST6 mRNA | increases expression | mRNA | 15331132 | 
| C051268 | 56548 | CHST7 C6ST-2 GST-5 | carbohydrate (N-acetylglucosamine 6-O) sulfotransferase 7 (EC:2.8.2.17) | 2-hydroxychavicol results in increased expression of CHST7 mRNA | increases expression | mRNA | 15331132 | 
| C051268 | 1565 | CYP2D6 CPD6 CYP2D CYP2D7AP CYP2D7BP CYP2D7P2 CYP2D8P2 CYP2DL1 CYPIID6 P450-DB1 P450C2D P450DB1 | cytochrome P450, family 2, subfamily D, polypeptide 6 (EC:1.14.14.1) | [CYP2D6 protein results in increased metabolism of Eugenol] which results in increased abundance of 2-hydroxychavicol | increases abundance / increases metabolic processing | protein | 15576237 | 
| C051268 | 2953 | GSTT2 GSTT2B | glutathione S-transferase theta 2 (EC:2.5.1.18) | 2-hydroxychavicol results in increased expression of GSTT2 mRNA | increases expression | mRNA | 15331132 | 
| C051268 | 8520 | HAT1 KAT1 | histone acetyltransferase 1 (EC:2.3.1.48) | 2-hydroxychavicol results in increased expression of HAT1 mRNA | increases expression | mRNA | 15331132 | 
| C051268 | 5743 | PTGS2 COX-2 COX2 GRIPGHS PGG/HS PGHS-2 PHS-2 hCox-2 | prostaglandin-endoperoxide synthase 2 (prostaglandin G/H synthase and cyclooxygenase) (EC:1.14.99.1) | 2-hydroxychavicol results in increased expression of PTGS2 mRNA | increases expression | mRNA | 12969226 | 
| C051268 | 5743 | PTGS2 COX-2 COX2 GRIPGHS PGG/HS PGHS-2 PHS-2 hCox-2 | prostaglandin-endoperoxide synthase 2 (prostaglandin G/H synthase and cyclooxygenase) (EC:1.14.99.1) | 2-hydroxychavicol results in increased expression of PTGS2 protein | increases expression | protein | 12969226 15331132 | 
| C051268 | 7172 | TPMT | thiopurine S-methyltransferase (EC:2.1.1.67) | 2-hydroxychavicol results in increased expression of TPMT mRNA | increases expression | mRNA | 15331132 |