| id | C00004778 |
|---|---|
| Name | Hexamethylmyricetin / Hexa-O-methylmyricitin / Myricetin hexamethyl ether / 3,5,7,3',4',5'-Hexamethoxyflavone / 3,5,7-Trimethoxy-2-(3,4,5-trimethoxyphenyl)-4H-1-benzopyran-4-one |
| CAS RN | 14813-27-5 |
| Standard InChI | InChI=1S/C21H22O8/c1-23-12-9-13(24-2)17-14(10-12)29-19(21(28-6)18(17)22)11-7-15(25-3)20(27-5)16(8-11)26-4/h7-10H,1-6H3 |
| Standard InChI (Main Layer) | InChI=1S/C21H22O8/c1-23-12-9-13(24-2)17-14(10-12)29-19(21(28-6)18(17)22)11-7-15(25-3)20(27-5)16(8-11)26-4/h7-10H,1-6H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 8 |
| By standard InChI | CHEMBL357089 |
|---|---|
| By standard InChI Main Layer | CHEMBL357089 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Ficus altissima | 309270 | Moraceae | rosids | Viridiplantae |
| Murraya paniculata | 43711 | Rutaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P33765 | Adenosine receptor A3 | Adenosine receptor | CHEMBL357089 |
CHEMBL638578
(1)
CHEMBL649050
(1)
|
0 / 0 |