| id | C00004864 |
|---|---|
| Name | 5,7,3'-Trihydroxy-3,6,8,4',5'-pentamethoxyflavone |
| CAS RN | 96887-20-6 |
| Standard InChI | InChI=1S/C20H20O10/c1-25-10-7-8(6-9(21)16(10)26-2)15-19(28-4)13(23)11-12(22)18(27-3)14(24)20(29-5)17(11)30-15/h6-7,21-22,24H,1-5H3 |
| Standard InChI (Main Layer) | InChI=1S/C20H20O10/c1-25-10-7-8(6-9(21)16(10)26-2)15-19(28-4)13(23)11-12(22)18(27-3)14(24)20(29-5)17(11)30-15/h6-7,21-22,24H,1-5H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 8 |
| By standard InChI | CHEMBL74923 |
|---|---|
| By standard InChI Main Layer | CHEMBL74923 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 3 |
| family name | count |
|---|---|
| Asteraceae | 3 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Gutierrezia grandis | 71047 | Asteraceae | asterids | Viridiplantae |
| Gutierrezia microcephala | 71047 | Asteraceae | asterids | Viridiplantae |
| Gymnosperma glutinosum | 71050 | Asteraceae | asterids | Viridiplantae |