| id | C00048958 |
|---|---|
| Name | Butyl acetate |
| CAS RN | 123-86-4 |
| Standard InChI | InChI=1S/C6H12O2/c1-3-4-5-8-6(2)7/h3-5H2,1-2H3 |
| Standard InChI (Main Layer) | InChI=1S/C6H12O2/c1-3-4-5-8-6(2)7/h3-5H2,1-2H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4274 |
| By standard InChI | CHEMBL284391 |
|---|---|
| By standard InChI Main Layer | CHEMBL284391 |
| By LinkDB | C12304 |
|---|
| By CAS RN | C006848 |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Olea europaea | 4146 | Oleaceae | asterids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL284391 |
CHEMBL1614458
(1)
|
0 / 0 |