id | C00048958 |
---|---|
Name | Butyl acetate |
CAS RN | 123-86-4 |
Standard InChI | InChI=1S/C6H12O2/c1-3-4-5-8-6(2)7/h3-5H2,1-2H3 |
Standard InChI (Main Layer) | InChI=1S/C6H12O2/c1-3-4-5-8-6(2)7/h3-5H2,1-2H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 4274 |
By standard InChI | CHEMBL284391 |
---|---|
By standard InChI Main Layer | CHEMBL284391 |
By LinkDB | C12304 |
---|
By CAS RN | C006848 |
---|
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Olea europaea | 4146 | Oleaceae | asterids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P00352 | Retinal dehydrogenase 1 | Enzyme | CHEMBL284391 |
CHEMBL1614458
(1)
|
0 / 0 |