| id | C00049136 | 
|---|---|
| Name | cis-Martynoside / (-)-cis-Martynoside | 
| CAS RN | 155899-92-6 | 
| Standard InChI | InChI=1S/C31H40O15/c1-15-24(36)25(37)26(38)31(43-15)46-29-27(39)30(42-11-10-17-5-8-20(40-2)19(34)12-17)44-22(14-32)28(29)45-23(35)9-6-16-4-7-18(33)21(13-16)41-3/h4-9,12-13,15,22,24-34,36-39H,10-11,14H2,1-3H3/b9-6-/t15-,22+,24-,25+,26+,27+,28+,29+,30+,31-/m0/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C31H40O15/c1-15-24(36)25(37)26(38)31(43-15)46-29-27(39)30(42-11-10-17-5-8-20(40-2)19(34)12-17)44-22(14-32)28(29)45-23(35)9-6-16-4-7-18(33)21(13-16)41-3/h4-9,12-13,15,22,24-34,36-39H,10-11,14H2,1-3H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 33 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL234764 CHEMBL503531 CHEMBL2134071 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| class name | count | 
|---|---|
| asterids | 1 | 
| family name | count | 
|---|---|
| Plantaginaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Penstemon serrulatus | 388205 | Plantaginaceae | asterids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P63092 | Guanine nucleotide-binding protein G(s) subunit alpha isoforms short | Other membrane protein | CHEMBL2134071 | CHEMBL2114810
                        (1) | 7 / 3 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #219080 | Acth-independent macronodular adrenal hyperplasia; aimah | P63092 | 
| #174800 | Mccune-albright syndrome; mas | P63092 | 
| #166350 | Osseous heteroplasia, progressive; poh | P63092 | 
| #102200 | Pituitary adenoma, growth hormone-secreting | P63092 | 
| #103580 | Pseudohypoparathyroidism, type ia; php1a | P63092 | 
| #603233 | Pseudohypoparathyroidism, type ib; php1b | P63092 | 
| #612462 | Pseudohypoparathyroidism, type ic; php1c | P63092 |