| id | C00049340 |
|---|---|
| Name | (Z)-3-Bromohymenialdisine |
| CAS RN | 175421-15-5 |
| Standard InChI | InChI=1S/C11H9Br2N5O2/c12-5-4-3(6-10(20)18-11(14)17-6)1-2-15-9(19)7(4)16-8(5)13/h16H,1-2H2,(H,15,19)(H3,14,17,18,20)/b6-3- |
| Standard InChI (Main Layer) | InChI=1S/C11H9Br2N5O2/c12-5-4-3(6-10(20)18-11(14)17-6)1-2-15-9(19)7(4)16-8(5)13/h16H,1-2H2,(H,15,19)(H3,14,17,18,20) |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1755 |
| By standard InChI | CHEMBL480350 |
|---|---|
| By standard InChI Main Layer | CHEMBL480350 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Axinellidae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Stylissa carteri | 279588 | Axinellidae | Metazoa |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| O14757 | Serine/threonine-protein kinase Chk1 | Chk1 | CHEMBL480350 |
CHEMBL990372
(1)
|
0 / 0 |