| id | C00004989 |
|---|---|
| Name | Gnaphaliin 7-epoxymethylbutyl ether |
| CAS RN | 94390-13-3 |
| Standard InChI | InChI=1S/C22H22O7/c1-22(2)15(29-22)11-27-14-10-13(23)16-17(24)21(26-4)18(12-8-6-5-7-9-12)28-20(16)19(14)25-3/h5-10,15,23H,11H2,1-4H3 |
| Standard InChI (Main Layer) | InChI=1S/C22H22O7/c1-22(2)15(29-22)11-27-14-10-13(23)16-17(24)21(26-4)18(12-8-6-5-7-9-12)28-20(16)19(14)25-3/h5-10,15,23H,11H2,1-4H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 4512 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 1 |
| family name | count |
|---|---|
| Asteraceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Achyrocline flaccida | 746492 | Asteraceae | asterids | Viridiplantae |