| id | C00049947 | 
|---|---|
| Name | 3-epi-Fagomine | 
| CAS RN | 156639-77-9 | 
| Standard InChI | InChI=1S/C6H13NO3/c8-3-4-6(10)5(9)1-2-7-4/h4-10H,1-3H2/t4-,5+,6-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C6H13NO3/c8-3-4-6(10)5(9)1-2-7-4/h4-10H,1-3H2 | 
| Phytochemical cluster | No. 1 | 
|---|---|
| KCF-S cluster | No. 786 | 
| By standard InChI | CHEMBL456583 | 
|---|---|
| By standard InChI Main Layer | CHEMBL303545 CHEMBL108084 CHEMBL456583 CHEMBL505237 CHEMBL1818435 CHEMBL1818436 CHEMBL1818437 CHEMBL1818438 CHEMBL1818439 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Xanthocercis zambesiaca | 53932 | Fabaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P04062 | Glucosylceramidase | Enzyme | CHEMBL108084 CHEMBL456583 CHEMBL505237 CHEMBL1818435 CHEMBL1818436 CHEMBL1818437 CHEMBL1818438 CHEMBL1818439 | CHEMBL818908
                        (1)
                        CHEMBL823890
                        (1) CHEMBL993570 (1) CHEMBL1820866 (8) | 6 / 4 | 
| Q14697 | Neutral alpha-glucosidase AB | Enzyme | CHEMBL108084 CHEMBL456583 CHEMBL1818438 | CHEMBL641729
                        (2)
                        CHEMBL641730
                        (1) CHEMBL645811 (2) CHEMBL645965 (3) CHEMBL645968 (3) CHEMBL646085 (2) CHEMBL646086 (1) CHEMBL822532 (1) CHEMBL822537 (1) | 0 / 0 | 
| P10253 | Lysosomal alpha-glucosidase | Hydrolase | CHEMBL108084 | CHEMBL993568
                        (1) | 1 / 1 | 
| P04066 | Tissue alpha-L-fucosidase | Enzyme | CHEMBL108084 CHEMBL456583 CHEMBL1818438 | CHEMBL649569
                        (2)
                        CHEMBL649571
                        (1) | 1 / 2 | 
| Q9HCG7 | Non-lysosomal glucosylceramidase | Enzyme | CHEMBL108084 CHEMBL456583 CHEMBL505237 CHEMBL1818435 CHEMBL1818436 CHEMBL1818437 CHEMBL1818438 CHEMBL1818439 | CHEMBL2015864
                        (8) | 1 / 0 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #230000 | Fucosidosis | P04066 | 
| #608013 | Gaucher disease, perinatal lethal | P04062 | 
| #230800 | Gaucher disease, type i | P04062 | 
| #230900 | Gaucher disease, type ii | P04062 | 
| #231000 | Gaucher disease, type iii | P04062 | 
| #231005 | Gaucher disease, type iiic | P04062 | 
| #232300 | Glycogen storage disease ii | P10253 | 
| #168600 | Parkinson disease, late-onset; pd | P04062 | 
| #614409 | Spastic paraplegia 46, autosomal recessive; spg46 | Q9HCG7 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00066 | Lewy body dementia (LBD) | P04062
                            (related) | 
| H00126 | Gaucher disease | P04062
                            (related) | 
| H00426 | Defects in the degradation of ganglioside | P04062
                            (related) | 
| H00810 | Progressive myoclonic epilepsy (PME) | P04062
                            (related) | 
| H00141 | Fucosidosis | P04066
                            (related) | 
| H00422 | Glycoproteinoses | P04066
                            (related) | 
| H00069 | Glycogen storage diseases (GSD) | P10253
                            (related) |