| id | C00005080 |
|---|---|
| Name | Sarothranol / 8-(3,4-Dihydroxyphenyl)-5-hydroxy-7-methoxy-2,2-dimethyl-2H,6H-benzo[1,2-b:5,4-b']dipyran-6-one |
| CAS RN | 149415-60-1 |
| Standard InChI | InChI=1S/C21H18O7/c1-21(2)7-6-11-14(28-21)9-15-16(17(11)24)18(25)20(26-3)19(27-15)10-4-5-12(22)13(23)8-10/h4-9,22-24H,1-3H3 |
| Standard InChI (Main Layer) | InChI=1S/C21H18O7/c1-21(2)7-6-11-14(28-21)9-15-16(17(11)24)18(25)20(26-3)19(27-15)10-4-5-12(22)13(23)8-10/h4-9,22-24H,1-3H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 24 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| family name | count |
|---|---|
| Hypericaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Hypericum japonicum | 282542 | Hypericaceae | rosids | Viridiplantae |