| id | C00005184 |
|---|---|
| Name | Kaempferol 3-glucoside-7-rhamnoside |
| CAS RN | 2392-95-2 |
| Standard InChI | InChI=1S/C27H30O15/c1-9-17(31)20(34)22(36)26(38-9)39-12-6-13(30)16-14(7-12)40-24(10-2-4-11(29)5-3-10)25(19(16)33)42-27-23(37)21(35)18(32)15(8-28)41-27/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3/t9?,15?,17-,18+,20-,21?,22?,23?,26-,27-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C27H30O15/c1-9-17(31)20(34)22(36)26(38-9)39-12-6-13(30)16-14(7-12)40-24(10-2-4-11(29)5-3-10)25(19(16)33)42-27-23(37)21(35)18(32)15(8-28)41-27/h2-7,9,15,17-18,20-23,26-32,34-37H,8H2,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 1 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1929192 CHEMBL1929193 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 7 |
| Euphyllophyta | 4 |
| asterids | 2 |
| Embryophyta | 1 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Fabaceae | 4 |
| Asteraceae | 2 |
| Aspleniaceae | 2 |
| Equisetaceae | 2 |
| Hymenophytaceae | 1 |
| Cucurbitaceae | 1 |
| Elaeagnaceae | 1 |
| Malvaceae | 1 |
| Ranunculaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL1929192 CHEMBL1929193 |
CHEMBL1932251
(2)
CHEMBL1932252
(1)
CHEMBL1932253 (2) |
0 / 0 |
| P11388 | DNA topoisomerase 2-alpha | Isomerase | CHEMBL1929192 CHEMBL1929193 |
CHEMBL1932254
(2)
CHEMBL1932258
(1)
CHEMBL1932265 (1) |
0 / 0 |