| id | C00005206 |
|---|---|
| Name | Mauritianin / 3-O-[2,6-di-O-alpha-L-rhamnopyranosyl-beta-D-galactopyranosyl] kaempferol |
| CAS RN | 109008-28-8 |
| Standard InChI | InChI=1S/C33H40O19/c1-10-19(37)23(41)26(44)31(47-10)46-9-17-21(39)25(43)30(52-32-27(45)24(42)20(38)11(2)48-32)33(50-17)51-29-22(40)18-15(36)7-14(35)8-16(18)49-28(29)12-3-5-13(34)6-4-12/h3-8,10-11,17,19-21,23-27,30-39,41-45H,9H2,1-2H3/t10?,11?,17?,19-,20-,21-,23-,24?,25?,26?,27-,30?,31+,32-,33-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C33H40O19/c1-10-19(37)23(41)26(44)31(47-10)46-9-17-21(39)25(43)30(52-32-27(45)24(42)20(38)11(2)48-32)33(50-17)51-29-22(40)18-15(36)7-14(35)8-16(18)49-28(29)12-3-5-13(34)6-4-12/h3-8,10-11,17,19-21,23-27,30-39,41-45H,9H2,1-2H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 5 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL362593 CHEMBL1454324 CHEMBL2005346 |
| By LinkDB |
|---|
| By CAS RN | C069907 |
|---|
| class name | count |
|---|---|
| asterids | 5 |
| rosids | 2 |
| eudicotyledons | 1 |
| family name | count |
|---|---|
| Primulaceae | 3 |
| Fabaceae | 2 |
| Amaranthaceae | 1 |
| Cornaceae | 1 |
| Apocynaceae | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P11387 | DNA topoisomerase 1 | Isomerase | CHEMBL362593 |
CHEMBL832445
(1)
CHEMBL832449
(1)
CHEMBL832450 (1) |
0 / 0 |