| id | C00000569 |
|---|---|
| Name | Emodin anthrone / Frangula emodin anthrone |
| CAS RN | 491-60-1 |
| Standard InChI | InChI=1S/C15H12O4/c1-7-2-8-4-9-5-10(16)6-12(18)14(9)15(19)13(8)11(17)3-7/h2-3,5-6,16-18H,4H2,1H3 |
| Standard InChI (Main Layer) | InChI=1S/C15H12O4/c1-7-2-8-4-9-5-10(16)6-12(18)14(9)15(19)13(8)11(17)3-7/h2-3,5-6,16-18H,4H2,1H3 |
| Phytochemical cluster | No. 61 |
|---|---|
| KCF-S cluster | No. 3961 |
| By standard InChI | CHEMBL122192 |
|---|---|
| By standard InChI Main Layer | CHEMBL122192 |
| By LinkDB |
|---|
| By CAS RN | C049933 |
|---|
| class name | count |
|---|
| family name | count |
|---|---|
| Aspergillaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Aspergillus terreus IMI16043 | 5052 | Aspergillaceae | Fungi |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| Q9H244 | P2Y purinoceptor 12 | Purine receptor | CHEMBL122192 |
CHEMBL995340
(1)
CHEMBL995341
(1)
|
1 / 1 |