id | C00000569 |
---|---|
Name | Emodin anthrone / Frangula emodin anthrone |
CAS RN | 491-60-1 |
Standard InChI | InChI=1S/C15H12O4/c1-7-2-8-4-9-5-10(16)6-12(18)14(9)15(19)13(8)11(17)3-7/h2-3,5-6,16-18H,4H2,1H3 |
Standard InChI (Main Layer) | InChI=1S/C15H12O4/c1-7-2-8-4-9-5-10(16)6-12(18)14(9)15(19)13(8)11(17)3-7/h2-3,5-6,16-18H,4H2,1H3 |
Phytochemical cluster | No. 61 |
---|---|
KCF-S cluster | No. 3961 |
By standard InChI | CHEMBL122192 |
---|---|
By standard InChI Main Layer | CHEMBL122192 |
By LinkDB |
---|
By CAS RN | C049933 |
---|
class name | count |
---|
family name | count |
---|---|
Aspergillaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Aspergillus terreus IMI16043 | 5052 | Aspergillaceae | Fungi |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
Q9H244 | P2Y purinoceptor 12 | Purine receptor | CHEMBL122192 |
CHEMBL995340
(1)
CHEMBL995341
(1)
|
1 / 1 |