| id | C00000572 | 
|---|---|
| Name | Sulochrin | 
| CAS RN | 519-57-3 | 
| Standard InChI | InChI=1S/C17H16O7/c1-8-4-11(19)15(12(20)5-8)16(21)14-10(17(22)24-3)6-9(18)7-13(14)23-2/h4-7,18-20H,1-3H3 | 
| Standard InChI (Main Layer) | InChI=1S/C17H16O7/c1-8-4-11(19)15(12(20)5-8)16(21)14-10(17(22)24-3)6-9(18)7-13(14)23-2/h4-7,18-20H,1-3H3 | 
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 1795 | 
| By standard InChI | CHEMBL61133 | 
|---|---|
| By standard InChI Main Layer | CHEMBL61133 | 
| By LinkDB | C00495 | 
|---|
| By CAS RN | C111298 | 
|---|
| class name | count | 
|---|
| family name | count | 
|---|---|
| Aspergillaceae | 2 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Aspergillus sp. | 5065 | Aspergillaceae | Fungi | |
| Aspergillus terreus IMI16043 | 5052 | Aspergillaceae | Fungi | 
| accession | description | class description | compound | assay ID (# of activities) | # of diseases (OMIM / KEGG) | 
|---|---|---|---|---|---|
| P06746 | DNA polymerase beta | Enzyme | CHEMBL61133 | CHEMBL1614079
                        (1) | 0 / 0 | 
| P10253 | Lysosomal alpha-glucosidase | Hydrolase | CHEMBL61133 | CHEMBL1614076
                        (1) | 1 / 1 | 
| P84022 | Mothers against decapentaplegic homolog 3 | Unclassified protein | CHEMBL61133 | CHEMBL1794584
                        (1) | 2 / 0 | 
| O75496 | Geminin | Unclassified protein | CHEMBL61133 | CHEMBL2114843
                        (1) | 0 / 0 | 
| Q9Y253 | DNA polymerase eta | Enzyme | CHEMBL61133 | CHEMBL1794569
                        (1) | 1 / 1 | 
| Q9UNA4 | DNA polymerase iota | Enzyme | CHEMBL61133 | CHEMBL1794483
                        (1) | 0 / 0 | 
| O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL61133 | CHEMBL1737991
                        (1) | 0 / 0 | 
| P27695 | DNA-(apurinic or apyrimidinic site) lyase | Enzyme | CHEMBL61133 | CHEMBL1614211
                        (1) | 0 / 0 | 
| Q9UBT6 | DNA polymerase kappa | Enzyme | CHEMBL61133 | CHEMBL1794536
                        (1) | 0 / 0 | 
| P46063 | ATP-dependent DNA helicase Q1 | Enzyme | CHEMBL61133 | CHEMBL1613829
                        (1)
                        CHEMBL1794433
                        (1) | 0 / 0 | 
| Q13951 | Core-binding factor subunit beta | Unclassified protein | CHEMBL61133 | CHEMBL1613933
                        (1) | 0 / 1 | 
| Q01196 | Runt-related transcription factor 1 | Unclassified protein | CHEMBL61133 | CHEMBL1613933
                        (1) | 1 / 6 | 
| OMIM | preferred title | UniProt | 
|---|---|---|
| #114500 | Colorectal cancer; crc | P84022 | 
| #232300 | Glycogen storage disease ii | P10253 | 
| #613795 | Loeys-dietz syndrome, type 3; lds3 | P84022 | 
| #601399 | Platelet disorder, familial, with associated myeloid malignancy | Q01196 | 
| #278750 | Xeroderma pigmentosum, variant type; xpv | Q9Y253 | 
| KEGG | disease name | UniProt | 
|---|---|---|
| H00069 | Glycogen storage diseases (GSD) | P10253
                            (related) | 
| H00001 | Acute lymphoblastic leukemia (ALL) (precursor B lymphoblastic leukemia) | Q01196
                            (related) Q01196 (marker) | 
| H00003 | Acute myeloid leukemia (AML) | Q01196
                            (related) Q01196 (marker) Q13951 (marker) | 
| H00004 | Chronic myeloid leukemia (CML) | Q01196
                            (related) | 
| H00978 | Thrombocytopenia (THC) | Q01196
                            (related) | 
| H00403 | Disorders of nucleotide excision repair | Q9Y253
                            (related) |