id | C00005731 |
---|---|
Name | Myricetin 3-glucuronide |
CAS RN | 77363-65-6 |
Standard InChI | InChI=1S/C21H18O14/c22-6-3-7(23)11-10(4-6)33-17(5-1-8(24)12(26)9(25)2-5)18(13(11)27)34-21-16(30)14(28)15(29)19(35-21)20(31)32/h1-4,14-16,19,21-26,28-30H,(H,31,32)/t14?,15-,16?,19-,21+/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C21H18O14/c22-6-3-7(23)11-10(4-6)33-17(5-1-8(24)12(26)9(25)2-5)18(13(11)27)34-21-16(30)14(28)15(29)19(35-21)20(31)32/h1-4,14-16,19,21-26,28-30H,(H,31,32) |
Phytochemical cluster | No. 15 |
---|---|
KCF-S cluster | No. 2 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL458470 |
By LinkDB |
---|
By CAS RN | C072578 |
---|
class name | count |
---|---|
rosids | 7 |
asterids | 3 |
eudicotyledons | 1 |
family name | count |
---|---|
Betulaceae | 2 |
Ericaceae | 2 |
Myrtaceae | 2 |
Rosaceae | 1 |
Polemoniaceae | 1 |
Lythraceae | 1 |
Vitaceae | 1 |
Polygonaceae | 1 |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P35354 | Prostaglandin G/H synthase 2 | Oxidoreductase | CHEMBL458470 |
CHEMBL1008495
(1)
|
0 / 3 |
P23219 | Prostaglandin G/H synthase 1 | Oxidoreductase | CHEMBL458470 |
CHEMBL1008496
(1)
|
0 / 0 |