id | C00005805 |
---|---|
Name | Ikarisoside A |
CAS RN | 55395-07-8 |
Standard InChI | InChI=1S/C26H28O10/c1-11(2)4-9-15-16(28)10-17(29)18-20(31)25(36-26-22(33)21(32)19(30)12(3)34-26)23(35-24(15)18)13-5-7-14(27)8-6-13/h4-8,10,12,19,21-22,26-30,32-33H,9H2,1-3H3/t12?,19-,21?,22-,26-/m0/s1 |
Standard InChI (Main Layer) | InChI=1S/C26H28O10/c1-11(2)4-9-15-16(28)10-17(29)18-20(31)25(36-26-22(33)21(32)19(30)12(3)34-26)23(35-24(15)18)13-5-7-14(27)8-6-13/h4-8,10,12,19,21-22,26-30,32-33H,9H2,1-3H3 |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 371 |
By standard InChI | |
---|---|
By standard InChI Main Layer | CHEMBL1728934 |
By LinkDB |
---|
By CAS RN | C092398 |
---|
class name | count |
---|---|
eudicotyledons | 3 |
family name | count |
---|---|
Berberidaceae | 3 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Epimedium koreanum | 63351 | Berberidaceae | eudicotyledons | Viridiplantae |
Epimedium sempervirens | 253615 | Berberidaceae | eudicotyledons | Viridiplantae |
Epimedium wushanense | 253611 | Berberidaceae | eudicotyledons | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P17405 | Sphingomyelin phosphodiesterase | Enzyme | CHEMBL1728934 |
CHEMBL1794495
(1)
|
2 / 2 |
P43220 | Glucagon-like peptide 1 receptor | Glucagon-like peptide receptor | CHEMBL1728934 |
CHEMBL2114788
(1)
|
0 / 0 |
O75164 | Lysine-specific demethylase 4A | Enzyme | CHEMBL1728934 |
CHEMBL1737991
(1)
|
0 / 0 |
P61088 | Ubiquitin-conjugating enzyme E2 N | Enzyme | CHEMBL1728934 |
CHEMBL1738239
(1)
|
0 / 0 |