| id | C00005868 |
|---|---|
| Name | Kaempferol 3-(2'',4''-di-(E)-p-coumarylrhamnoside) |
| CAS RN | 163434-73-9 |
| Standard InChI | InChI=1S/C39H32O14/c1-20-35(51-30(45)16-6-21-2-10-24(40)11-3-21)34(48)38(52-31(46)17-7-22-4-12-25(41)13-5-22)39(49-20)53-37-33(47)32-28(44)18-27(43)19-29(32)50-36(37)23-8-14-26(42)15-9-23/h2-20,34-35,38-44,48H,1H3/b16-6+,17-7+/t20?,34?,35-,38-,39-/m0/s1 |
| Standard InChI (Main Layer) | InChI=1S/C39H32O14/c1-20-35(51-30(45)16-6-21-2-10-24(40)11-3-21)34(48)38(52-31(46)17-7-22-4-12-25(41)13-5-22)39(49-20)53-37-33(47)32-28(44)18-27(43)19-29(32)50-36(37)23-8-14-26(42)15-9-23/h2-20,34-35,38-44,48H,1H3 |
| Phytochemical cluster | |
|---|---|
| KCF-S cluster | No. 231 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL1642586 CHEMBL1797052 |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| asterids | 7 |
| Magnoliophyta | 1 |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P98170 | E3 ubiquitin-protein ligase XIAP | Other cytosolic protein | CHEMBL1642586 |
CHEMBL1646332
(1)
|
1 / 1 |