| id | C00005873 | 
|---|---|
| Name | Biondnoid A / Buddlenoid A / Kaempferol 7-(6''-p-coumarylglucoside) | 
| CAS RN | 142750-32-1 | 
| Standard InChI | InChI=1S/C30H26O13/c31-16-6-1-14(2-7-16)3-10-22(34)40-13-21-24(35)26(37)28(39)30(43-21)41-18-11-19(33)23-20(12-18)42-29(27(38)25(23)36)15-4-8-17(32)9-5-15/h1-12,21,24,26,28,30-33,35,37-39H,13H2/b10-3+/t21?,24-,26+,28?,30-/m1/s1 | 
| Standard InChI (Main Layer) | InChI=1S/C30H26O13/c31-16-6-1-14(2-7-16)3-10-22(34)40-13-21-24(35)26(37)28(39)30(43-21)41-18-11-19(33)23-20(12-18)42-29(27(38)25(23)36)15-4-8-17(32)9-5-15/h1-12,21,24,26,28,30-33,35,37-39H,13H2 | 
| Phytochemical cluster | No. 15 | 
|---|---|
| KCF-S cluster | No. 30 | 
| By standard InChI | |
|---|---|
| By standard InChI Main Layer | CHEMBL32646 CHEMBL449937 | 
| By LinkDB | 
|---|
| By CAS RN | 
|---|
| family name | count | 
|---|---|
| Scrophulariaceae | 1 | 
| Muntingiaceae | 1 | 
| KNApSAcK organism | *ID | *family | *plant class | *kingdom | 
|---|---|---|---|---|
| Buddleja coriacea | 26473 | Scrophulariaceae | asterids | Viridiplantae | 
| Muntingia calabura | 45164 | Muntingiaceae | rosids | Viridiplantae | 
| accession | description | class description | compound | assay ID (# of activities) | 
                        # of diseases
                         (OMIM / KEGG)  | 
                    
|---|---|---|---|---|---|
| P14679 | Tyrosinase | Oxidoreductase | CHEMBL32646 | 
                        CHEMBL814344
                        (1)
                         | 
                      4 / 2 |