| id | C00006258 |
|---|---|
| Name | Vitexin 2''-p-hydroxybenzoate |
| CAS RN | 10576-90-6 |
| Standard InChI | InChI=1S/C28H24O12/c29-11-20-23(35)24(36)27(40-28(37)13-3-7-15(31)8-4-13)26(39-20)22-17(33)9-16(32)21-18(34)10-19(38-25(21)22)12-1-5-14(30)6-2-12/h1-10,20,23-24,26-27,29-33,35-36H,11H2/t20?,23-,24+,26+,27?/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C28H24O12/c29-11-20-23(35)24(36)27(40-28(37)13-3-7-15(31)8-4-13)26(39-20)22-17(33)9-16(32)21-18(34)10-19(38-25(21)22)12-1-5-14(30)6-2-12/h1-10,20,23-24,26-27,29-33,35-36H,11H2 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 30 |
| By standard InChI | |
|---|---|
| By standard InChI Main Layer |
| By LinkDB |
|---|
| By CAS RN |
|---|
| class name | count |
|---|---|
| rosids | 1 |
| eudicotyledons | 1 |
| asterids | 1 |
| family name | count |
|---|---|
| Fabaceae | 1 |
| Ranunculaceae | 1 |
| Lamiaceae | 1 |
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Cytisus scoparius | 3835 | Fabaceae | rosids | Viridiplantae |
| Trollius ledebouri | 46346 | Ranunculaceae | eudicotyledons | Viridiplantae |
| Vitex lucens | 384982 | Lamiaceae | asterids | Viridiplantae |