| id | C00000651 |
|---|---|
| Name | (+)-Pisatin / 6a-Hydroxy-3-methoxy-8,9-methylenedioxypterocarpan |
| CAS RN | 469-01-2 |
| Standard InChI | InChI=1S/C17H14O6/c1-19-9-2-3-10-12(4-9)20-7-17(18)11-5-14-15(22-8-21-14)6-13(11)23-16(10)17/h2-6,16,18H,7-8H2,1H3/t16-,17+/m1/s1 |
| Standard InChI (Main Layer) | InChI=1S/C17H14O6/c1-19-9-2-3-10-12(4-9)20-7-17(18)11-5-14-15(22-8-21-14)6-13(11)23-16(10)17/h2-6,16,18H,7-8H2,1H3 |
| Phytochemical cluster | No. 15 |
|---|---|
| KCF-S cluster | No. 396 |
| By standard InChI | CHEMBL1784262 |
|---|---|
| By standard InChI Main Layer | CHEMBL1784262 |
| By LinkDB | C10516 |
|---|
| By CAS RN |
|---|
| KNApSAcK organism | *ID | *family | *plant class | *kingdom |
|---|---|---|---|---|
| Caragana spp. | 20483 | Fabaceae | rosids | Viridiplantae |
| Lathyrus spp. | 3853 | Fabaceae | rosids | Viridiplantae |
| Pisum sativum | 3888 | Fabaceae | rosids | Viridiplantae |
| Tephrosia bidwillii | 3803 | Fabaceae | rosids | Viridiplantae |
| accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
|---|---|---|---|---|---|
| P03372 | Estrogen receptor | NR3A1 | CHEMBL1784262 |
CHEMBL1786579
(1)
CHEMBL1786581
(1)
|
1 / 1 |