id | C00000660 |
---|---|
Name | Feruloyl tyramine |
CAS RN | 65646-26-6 |
Standard InChI | InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22)/b9-5+ |
Standard InChI (Main Layer) | InChI=1S/C18H19NO4/c1-23-17-12-14(4-8-16(17)21)5-9-18(22)19-11-10-13-2-6-15(20)7-3-13/h2-9,12,20-21H,10-11H2,1H3,(H,19,22) |
Phytochemical cluster | |
---|---|
KCF-S cluster | No. 499 |
By standard InChI | CHEMBL206555 |
---|---|
By standard InChI Main Layer | CHEMBL206555 CHEMBL451720 |
By LinkDB | C02717 |
---|
By CAS RN | C074004 |
---|
family name | count |
---|---|
Convolvulaceae | 1 |
Salicaceae | 1 |
KNApSAcK organism | *ID | *family | *plant class | *kingdom |
---|---|---|---|---|
Jacquemontia paniculata | 112276 | Convolvulaceae | asterids | Viridiplantae |
Populus trichocarpa | 3694 | Salicaceae | rosids | Viridiplantae |
accession | description | class description | compound | assay ID (# of activities) |
# of diseases
(OMIM / KEGG) |
---|---|---|---|---|---|
P14679 | Tyrosinase | Oxidoreductase | CHEMBL206555 |
CHEMBL870666
(1)
|
4 / 2 |